C22H16N6Na2O11S2 — CID 137176581
CID 137176581 (PubChem CID 137176581) has the molecular formula C22H16N6Na2O11S2 and a molecular weight of 650.52 g/mol.
| Compound Name | CID 137176581 |
|---|---|
| PubChem CID | 137176581 |
| Molecular Formula | C22H16N6Na2O11S2 |
| Molecular Weight | 650.52 g/mol |
| Exact Mass | 650.01 |
| IUPAC Name | — |
| SMILES | Nc1cc(/N=N/c2cc(/N=N/c3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(O)c34)c(O)cc2O)ccc1[N+](=O)[O-].[Na].[Na] |
| InChI | InChI=1S/C22H16N6O11S2.2Na/c23-14-5-11(1-2-18(14)28(32)33)24-25-15-8-16(20(30)9-19(15)29)26-27-17-6-12(40(34,35)36)3-10-4-13(41(37,38)39)7-21(31)22(10)17;;/h1-9,29-31H,23H2,(H,34,35,36)(H,37,38,39);;/b25-24+,27-26+;; |
| InChIKey | ZYPPFFNHSVNZRP-JQIYNFIASA-N |
| XLogP | 4.01 |
| TPSA | 288.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|