C16H12N4O9S2 — CID 136610984
5-amino-4-hydroxy-8-[(2-nitro-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136610984) has the molecular formula C16H12N4O9S2 and a molecular weight of 468.43 g/mol. Its IUPAC name is 5-amino-4-hydroxy-8-[(2-nitro-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-amino-4-hydroxy-8-[(2-nitro-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136610984 |
| Molecular Formula | C16H12N4O9S2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 5-amino-4-hydroxy-8-[(2-nitro-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2[N+](=O)[O-])c2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C16H12N4O9S2/c17-11-2-4-12(10-5-9(31(27,28)29)7-15(21)16(10)11)18-19-13-3-1-8(30(24,25)26)6-14(13)20(22)23/h1-7,21H,17H2,(H,24,25,26)(H,27,28,29)/b19-18+ |
| InChIKey | LCCYGHMMBAWHSQ-VHEBQXMUSA-N |
| XLogP | 2.94 |
| TPSA | 222.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|