C17H13N3Na2O8S2 — CID 140667056
disodium;5-amino-4-hydroxy-8-[(4-methoxy-2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 140667056) has the molecular formula C17H13N3Na2O8S2 and a molecular weight of 497.42 g/mol. Its IUPAC name is disodium;5-amino-4-hydroxy-8-[(4-methoxy-2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;5-amino-4-hydroxy-8-[(4-methoxy-2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 140667056 |
| Molecular Formula | C17H13N3Na2O8S2 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | disodium;5-amino-4-hydroxy-8-[(4-methoxy-2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | COc1ccc(/N=N/c2ccc(N)c3c(O)cc(S(=O)(=O)[O-])cc23)c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C17H15N3O8S2.2Na/c1-28-9-2-4-14(16(6-9)30(25,26)27)20-19-13-5-3-12(18)17-11(13)7-10(8-15(17)21)29(22,23)24;;/h2-8,21H,18H2,1H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | GBPXMRPDBQNBCQ-LLIZZRELSA-L |
| XLogP | -3.63 |
| TPSA | 194.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|