C16H12ClN4NaO4S — CID 135764832
sodium 6-amino-5-[(4-amino-2-chlorophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonate (PubChem CID 135764832) has the molecular formula C16H12ClN4NaO4S and a molecular weight of 414.81 g/mol. Its IUPAC name is sodium 6-amino-5-[(4-amino-2-chlorophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonate.
| Compound Name | sodium 6-amino-5-[(4-amino-2-chlorophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135764832 |
| Molecular Formula | C16H12ClN4NaO4S |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | sodium 6-amino-5-[(4-amino-2-chlorophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonate |
| SMILES | Nc1ccc(/N=N/c2c(N)ccc3cc(S(=O)(=O)[O-])cc(O)c23)c(Cl)c1.[Na+] |
| InChI | InChI=1S/C16H13ClN4O4S.Na/c17-11-6-9(18)2-4-13(11)20-21-16-12(19)3-1-8-5-10(26(23,24)25)7-14(22)15(8)16;/h1-7,22H,18-19H2,(H,23,24,25);/q;+1/p-1/b21-20+; |
| InChIKey | CDOZEGQRFXBOME-ANVLNOONSA-M |
| XLogP | 0.69 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|