C26H21ClN8O9S3 — CID 136634101
6-amino-5-[[4-[[4-chloro-6-(4-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136634101) has the molecular formula C26H21ClN8O9S3 and a molecular weight of 721.15 g/mol. Its IUPAC name is 6-amino-5-[[4-[[4-chloro-6-(4-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-amino-5-[[4-[[4-chloro-6-(4-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136634101 |
| Molecular Formula | C26H21ClN8O9S3 |
| Molecular Weight | 721.15 g/mol |
| Exact Mass | 720.03 |
| IUPAC Name | 6-amino-5-[[4-[[4-chloro-6-(4-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(Nc2nc(Cl)nc(Nc3ccc(/N=N/c4c(N)ccc5cc(S(=O)(=O)O)cc(O)c45)c(S(=O)(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C26H21ClN8O9S3/c1-45(37,38)16-6-3-14(4-7-16)29-25-31-24(27)32-26(33-25)30-15-5-9-19(21(11-15)47(42,43)44)34-35-23-18(28)8-2-13-10-17(46(39,40)41)12-20(36)22(13)23/h2-12,36H,28H2,1H3,(H,39,40,41)(H,42,43,44)(H2,29,30,31,32,33)/b35-34+ |
| InChIKey | VWVYJMLQKSMDCK-XAHDOWKMSA-N |
| XLogP | 4.77 |
| TPSA | 276.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.15 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|