C17H14ClN3NaO7S2 — CID 170846621
CID 170846621 (PubChem CID 170846621) has the molecular formula C17H14ClN3NaO7S2 and a molecular weight of 494.89 g/mol.
| Compound Name | CID 170846621 |
|---|---|
| PubChem CID | 170846621 |
| Molecular Formula | C17H14ClN3NaO7S2 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | — |
| SMILES | Cc1cc(/N=N/c2c(N)ccc3cc(S(=O)(=O)O)cc(O)c23)c(S(=O)(=O)O)cc1Cl.[Na] |
| InChI | InChI=1S/C17H14ClN3O7S2.Na/c1-8-4-13(15(7-11(8)18)30(26,27)28)20-21-17-12(19)3-2-9-5-10(29(23,24)25)6-14(22)16(9)17;/h2-7,22H,19H2,1H3,(H,23,24,25)(H,26,27,28);/b21-20+; |
| InChIKey | DGBDOMGCFQFTKS-ANVLNOONSA-N |
| XLogP | 3.62 |
| TPSA | 179.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|