C34H28N6O5S — CID 137194224
6-amino-5-[[4-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137194224) has the molecular formula C34H28N6O5S and a molecular weight of 632.70 g/mol. Its IUPAC name is 6-amino-5-[[4-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-amino-5-[[4-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137194224 |
| Molecular Formula | C34H28N6O5S |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | 6-amino-5-[[4-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Cc1cc(-c2ccc(/N=N/c3c(N)ccc4cc(S(=O)(=O)O)cc(O)c34)c(C)c2)ccc1/N=N/c1c(N)ccc2cccc(O)c12 |
| InChI | InChI=1S/C34H28N6O5S/c1-18-14-21(8-12-27(18)37-39-33-25(35)10-6-20-4-3-5-29(41)31(20)33)22-9-13-28(19(2)15-22)38-40-34-26(36)11-7-23-16-24(46(43,44)45)17-30(42)32(23)34/h3-17,41-42H,35-36H2,1-2H3,(H,43,44,45)/b39-37+,40-38+ |
| InChIKey | WJYQTVPBOGCGNM-HVMBLDELSA-N |
| XLogP | 8.93 |
| TPSA | 196.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|