C34H28N6O9S3 — CID 10328109
3-amino-4-[[4-[4-[(2-amino-6-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1,7-disulfonic acid (PubChem CID 10328109) has the molecular formula C34H28N6O9S3 and a molecular weight of 760.83 g/mol. Its IUPAC name is 3-amino-4-[[4-[4-[(2-amino-6-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1,7-disulfonic acid.
| Compound Name | 3-amino-4-[[4-[4-[(2-amino-6-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 10328109 |
| Molecular Formula | C34H28N6O9S3 |
| Molecular Weight | 760.83 g/mol |
| Exact Mass | 760.11 |
| IUPAC Name | 3-amino-4-[[4-[4-[(2-amino-6-sulfonaphthalen-1-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1,7-disulfonic acid |
| SMILES | Cc1cc(-c2ccc(/N=N/c3c(N)cc(S(=O)(=O)O)c4cc(S(=O)(=O)O)ccc34)c(C)c2)ccc1/N=N/c1c(N)ccc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C34H28N6O9S3/c1-18-13-20(4-11-30(18)37-39-33-25-8-6-23(50(41,42)43)15-22(25)3-10-28(33)35)21-5-12-31(19(2)14-21)38-40-34-26-9-7-24(51(44,45)46)16-27(26)32(17-29(34)36)52(47,48)49/h3-17H,35-36H2,1-2H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)/b39-37+,40-38+ |
| InChIKey | XOJPVKWNCNWFEG-HVMBLDELSA-N |
| XLogP | 8.01 |
| TPSA | 264.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.83 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|