C26H24N4O7S2 — CID 136863141
4-[[2-[(2,4-dimethylphenyl)diazenyl]-4,6-dimethylphenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136863141) has the molecular formula C26H24N4O7S2 and a molecular weight of 568.63 g/mol. Its IUPAC name is 4-[[2-[(2,4-dimethylphenyl)diazenyl]-4,6-dimethylphenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[2-[(2,4-dimethylphenyl)diazenyl]-4,6-dimethylphenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136863141 |
| Molecular Formula | C26H24N4O7S2 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 4-[[2-[(2,4-dimethylphenyl)diazenyl]-4,6-dimethylphenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Cc1ccc(/N=N/c2cc(C)cc(C)c2/N=N/c2c(O)c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)c(C)c1 |
| InChI | InChI=1S/C26H24N4O7S2/c1-14-5-8-21(16(3)9-14)27-28-22-11-15(2)10-17(4)24(22)29-30-25-20-7-6-19(38(32,33)34)12-18(20)13-23(26(25)31)39(35,36)37/h5-13,31H,1-4H3,(H,32,33,34)(H,35,36,37)/b28-27+,30-29+ |
| InChIKey | AEYXDDLLNNAVLB-XOXGWFOHSA-N |
| XLogP | 7.10 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|