C25H22N4O6S2 — CID 89047064
7-[[4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 89047064) has the molecular formula C25H22N4O6S2 and a molecular weight of 538.61 g/mol. Its IUPAC name is 7-[[4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 89047064 |
| Molecular Formula | C25H22N4O6S2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 7-[[4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3ccc4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c4c3)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C25H22N4O6S2/c1-15-4-8-23(16(2)10-15)28-26-19-7-9-24(17(3)11-19)29-27-20-6-5-18-12-21(36(30,31)32)14-25(22(18)13-20)37(33,34)35/h4-14H,1-3H3,(H,30,31,32)(H,33,34,35)/b28-26+,29-27+ |
| InChIKey | FKTXXMWDKPOAMF-TUUFZWAFSA-N |
| XLogP | 7.09 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|