C17H15N3O9S3 — CID 14618435
7-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid (PubChem CID 14618435) has the molecular formula C17H15N3O9S3 and a molecular weight of 501.52 g/mol. Its IUPAC name is 7-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 7-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 14618435 |
| Molecular Formula | C17H15N3O9S3 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | 7-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid |
| SMILES | Cc1cc(N)ccc1/N=N/c1cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H15N3O9S3/c1-9-4-11(18)2-3-14(9)19-20-15-8-13-10(6-17(15)32(27,28)29)5-12(30(21,22)23)7-16(13)31(24,25)26/h2-8H,18H2,1H3,(H,21,22,23)(H,24,25,26)(H,27,28,29)/b20-19+ |
| InChIKey | SSIRUEVZMMICBV-FMQUCBEESA-N |
| XLogP | 2.89 |
| TPSA | 213.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|