C10H8N2O9S3 — CID 142234903
7-diazenylnaphthalene-1,3,6-trisulfonic acid (PubChem CID 142234903) has the molecular formula C10H8N2O9S3 and a molecular weight of 396.38 g/mol. Its IUPAC name is 7-diazenylnaphthalene-1,3,6-trisulfonic acid.
| Compound Name | 7-diazenylnaphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 142234903 |
| Molecular Formula | C10H8N2O9S3 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | 7-diazenylnaphthalene-1,3,6-trisulfonic acid |
| SMILES | [H]/N=N/c1cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C10H8N2O9S3/c11-12-8-4-7-5(2-10(8)24(19,20)21)1-6(22(13,14)15)3-9(7)23(16,17)18/h1-4,11H,(H,13,14,15)(H,16,17,18)(H,19,20,21)/b12-11+ |
| InChIKey | XQIAHMQBDWJPOI-VAWYXSNFSA-N |
| XLogP | 1.24 |
| TPSA | 199.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|