C20H14O13S4 — CID 166611301
6-(5,7-disulfonaphthalen-2-yl)oxynaphthalene-1,3-disulfonic acid (PubChem CID 166611301) has the molecular formula C20H14O13S4 and a molecular weight of 590.59 g/mol. Its IUPAC name is 6-(5,7-disulfonaphthalen-2-yl)oxynaphthalene-1,3-disulfonic acid.
| Compound Name | 6-(5,7-disulfonaphthalen-2-yl)oxynaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 166611301 |
| Molecular Formula | C20H14O13S4 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 589.93 |
| IUPAC Name | 6-(5,7-disulfonaphthalen-2-yl)oxynaphthalene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2ccc(Oc3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4c3)cc2c1 |
| InChI | InChI=1S/C20H14O13S4/c21-34(22,23)15-7-11-5-13(1-3-17(11)19(9-15)36(27,28)29)33-14-2-4-18-12(6-14)8-16(35(24,25)26)10-20(18)37(30,31)32/h1-10H,(H,21,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32) |
| InChIKey | QEOKIQXXXUIYLI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 226.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|