C26H18O15S2 — CID 87214682
4-sulfonaphthalene-2,7-dicarboxylic acid;5-(4-sulfophenoxy)benzene-1,3-dicarboxylic acid (PubChem CID 87214682) has the molecular formula C26H18O15S2 and a molecular weight of 634.55 g/mol. Its IUPAC name is 4-sulfonaphthalene-2,7-dicarboxylic acid;5-(4-sulfophenoxy)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-sulfonaphthalene-2,7-dicarboxylic acid;5-(4-sulfophenoxy)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87214682 |
| Molecular Formula | C26H18O15S2 |
| Molecular Weight | 634.55 g/mol |
| Exact Mass | 634.01 |
| IUPAC Name | 4-sulfonaphthalene-2,7-dicarboxylic acid;5-(4-sulfophenoxy)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(Oc2ccc(S(=O)(=O)O)cc2)cc(C(=O)O)c1.O=C(O)c1ccc2c(S(=O)(=O)O)cc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C14H10O8S.C12H8O7S/c15-13(16)8-5-9(14(17)18)7-11(6-8)22-10-1-3-12(4-2-10)23(19,20)21;13-11(14)6-1-2-9-7(3-6)4-8(12(15)16)5-10(9)20(17,18)19/h1-7H,(H,15,16)(H,17,18)(H,19,20,21);1-5H,(H,13,14)(H,15,16)(H,17,18,19) |
| InChIKey | GACBUCSTRIXWTR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 267.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|