C38H26O8S — CID 22404867
4-[4-[4-[4-[4-(4-carboxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzoic acid (PubChem CID 22404867) has the molecular formula C38H26O8S and a molecular weight of 642.69 g/mol. Its IUPAC name is 4-[4-[4-[4-[4-(4-carboxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzoic acid.
| Compound Name | 4-[4-[4-[4-[4-(4-carboxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 22404867 |
| Molecular Formula | C38H26O8S |
| Molecular Weight | 642.69 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | 4-[4-[4-[4-[4-(4-carboxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(Oc5ccc(-c6ccc(C(=O)O)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H26O8S/c39-37(40)29-5-1-25(2-6-29)27-9-13-31(14-10-27)45-33-17-21-35(22-18-33)47(43,44)36-23-19-34(20-24-36)46-32-15-11-28(12-16-32)26-3-7-30(8-4-26)38(41)42/h1-24H,(H,39,40)(H,41,42) |
| InChIKey | YFSBZFOXSALPSN-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.69 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |