About 4-phenoxybenzoic acid;hydrochloride
4-phenoxybenzoic acid;hydrochloride (PubChem CID 70385625) has the molecular formula C13H11ClO3
and a molecular weight of 250.68 g/mol. Its IUPAC name is 4-phenoxybenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-phenoxybenzoic acid;hydrochloride |
| PubChem CID | 70385625 |
| Molecular Formula | C13H11ClO3 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 4-phenoxybenzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O3.ClH/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11;/h1-9H,(H,14,15);1H |
| InChIKey | ZJARCXJVUWYDPB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenoxybenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxybenzoic acid;hydrochloride?
The IUPAC name of 4-phenoxybenzoic acid;hydrochloride (CID 70385625) is 4-phenoxybenzoic acid;hydrochloride.
What is the SMILES notation for 4-phenoxybenzoic acid;hydrochloride?
The canonical SMILES for 4-phenoxybenzoic acid;hydrochloride is Cl.O=C(O)c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-phenoxybenzoic acid;hydrochloride?
The InChIKey is ZJARCXJVUWYDPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.ClH/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11;/h1-9H,(H,14,15);1H.
What are the key properties of 4-phenoxybenzoic acid;hydrochloride?
4-phenoxybenzoic acid;hydrochloride has a molecular weight of 250.68 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxybenzoic acid;hydrochloride is sourced from PubChem (CID 70385625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).