C45H30O6 — CID 11571089
[3,5-bis(4-phenoxybenzoyl)phenyl]-(4-phenoxyphenyl)methanone (PubChem CID 11571089) has the molecular formula C45H30O6 and a molecular weight of 666.73 g/mol. Its IUPAC name is [3,5-bis(4-phenoxybenzoyl)phenyl]-(4-phenoxyphenyl)methanone.
| Compound Name | [3,5-bis(4-phenoxybenzoyl)phenyl]-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 11571089 |
| Molecular Formula | C45H30O6 |
| Molecular Weight | 666.73 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | [3,5-bis(4-phenoxybenzoyl)phenyl]-(4-phenoxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)c1cc(C(=O)c2ccc(Oc3ccccc3)cc2)cc(C(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C45H30O6/c46-43(31-16-22-40(23-17-31)49-37-10-4-1-5-11-37)34-28-35(44(47)32-18-24-41(25-19-32)50-38-12-6-2-7-13-38)30-36(29-34)45(48)33-20-26-42(27-21-33)51-39-14-8-3-9-15-39/h1-30H |
| InChIKey | RIMYCWLKFUKRDC-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.73 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |