C45H33N3O6 — CID 102447265
[4-(3-aminophenoxy)phenyl]-[3,5-bis[4-(3-aminophenoxy)benzoyl]phenyl]methanone (PubChem CID 102447265) has the molecular formula C45H33N3O6 and a molecular weight of 711.77 g/mol. Its IUPAC name is [4-(3-aminophenoxy)phenyl]-[3,5-bis[4-(3-aminophenoxy)benzoyl]phenyl]methanone.
| Compound Name | [4-(3-aminophenoxy)phenyl]-[3,5-bis[4-(3-aminophenoxy)benzoyl]phenyl]methanone |
|---|---|
| PubChem CID | 102447265 |
| Molecular Formula | C45H33N3O6 |
| Molecular Weight | 711.77 g/mol |
| Exact Mass | 711.24 |
| IUPAC Name | [4-(3-aminophenoxy)phenyl]-[3,5-bis[4-(3-aminophenoxy)benzoyl]phenyl]methanone |
| SMILES | Nc1cccc(Oc2ccc(C(=O)c3cc(C(=O)c4ccc(Oc5cccc(N)c5)cc4)cc(C(=O)c4ccc(Oc5cccc(N)c5)cc4)c3)cc2)c1 |
| InChI | InChI=1S/C45H33N3O6/c46-34-4-1-7-40(25-34)52-37-16-10-28(11-17-37)43(49)31-22-32(44(50)29-12-18-38(19-13-29)53-41-8-2-5-35(47)26-41)24-33(23-31)45(51)30-14-20-39(21-15-30)54-42-9-3-6-36(48)27-42/h1-27H,46-48H2 |
| InChIKey | AUEOXMSCCGVYLS-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 156.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.77 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|