C43H40N2O3 — CID 22415190
bis[4-[3-[2-(3-aminophenyl)propan-2-yl]phenoxy]phenyl]methanone (PubChem CID 22415190) has the molecular formula C43H40N2O3 and a molecular weight of 632.80 g/mol. Its IUPAC name is bis[4-[3-[2-(3-aminophenyl)propan-2-yl]phenoxy]phenyl]methanone.
| Compound Name | bis[4-[3-[2-(3-aminophenyl)propan-2-yl]phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 22415190 |
| Molecular Formula | C43H40N2O3 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | bis[4-[3-[2-(3-aminophenyl)propan-2-yl]phenoxy]phenyl]methanone |
| SMILES | CC(C)(c1cccc(N)c1)c1cccc(Oc2ccc(C(=O)c3ccc(Oc4cccc(C(C)(C)c5cccc(N)c5)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C43H40N2O3/c1-42(2,31-9-5-13-35(44)25-31)33-11-7-15-39(27-33)47-37-21-17-29(18-22-37)41(46)30-19-23-38(24-20-30)48-40-16-8-12-34(28-40)43(3,4)32-10-6-14-36(45)26-32/h5-28H,44-45H2,1-4H3 |
| InChIKey | JGKIQDNPHOVVAI-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|