C55H48N2O5 — CID 67683223
bis[4-[2-[4-(4-aminophenoxy)-2-phenoxyphenyl]propan-2-yl]phenyl]methanone (PubChem CID 67683223) has the molecular formula C55H48N2O5 and a molecular weight of 817.00 g/mol. Its IUPAC name is bis[4-[2-[4-(4-aminophenoxy)-2-phenoxyphenyl]propan-2-yl]phenyl]methanone.
| Compound Name | bis[4-[2-[4-(4-aminophenoxy)-2-phenoxyphenyl]propan-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 67683223 |
| Molecular Formula | C55H48N2O5 |
| Molecular Weight | 817.00 g/mol |
| Exact Mass | 816.36 |
| IUPAC Name | bis[4-[2-[4-(4-aminophenoxy)-2-phenoxyphenyl]propan-2-yl]phenyl]methanone |
| SMILES | CC(C)(c1ccc(C(=O)c2ccc(C(C)(C)c3ccc(Oc4ccc(N)cc4)cc3Oc3ccccc3)cc2)cc1)c1ccc(Oc2ccc(N)cc2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C55H48N2O5/c1-54(2,49-33-31-47(59-45-27-23-41(56)24-28-45)35-51(49)61-43-11-7-5-8-12-43)39-19-15-37(16-20-39)53(58)38-17-21-40(22-18-38)55(3,4)50-34-32-48(60-46-29-25-42(57)26-30-46)36-52(50)62-44-13-9-6-10-14-44/h5-36H,56-57H2,1-4H3 |
| InChIKey | ATYHNIGDFPWQQL-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.00 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|