C33H34O3 — CID 130415299
bis[4-(4-tert-butylphenoxy)phenyl]methanone (PubChem CID 130415299) has the molecular formula C33H34O3 and a molecular weight of 478.63 g/mol. Its IUPAC name is bis[4-(4-tert-butylphenoxy)phenyl]methanone.
| Compound Name | bis[4-(4-tert-butylphenoxy)phenyl]methanone |
|---|---|
| PubChem CID | 130415299 |
| Molecular Formula | C33H34O3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | bis[4-(4-tert-butylphenoxy)phenyl]methanone |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C(=O)c3ccc(Oc4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H34O3/c1-32(2,3)25-11-19-29(20-12-25)35-27-15-7-23(8-16-27)31(34)24-9-17-28(18-10-24)36-30-21-13-26(14-22-30)33(4,5)6/h7-22H,1-6H3 |
| InChIKey | VRTWCCVKUFFUJK-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |