C77H60Cl2O4P2 — CID 169426235
triphenyl-[4-[4-[4-[2-[4-[4-(4-triphenylphosphaniumylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]phosphanium dichloride (PubChem CID 169426235) has the molecular formula C77H60Cl2O4P2 and a molecular weight of 1182.18 g/mol. Its IUPAC name is triphenyl-[4-[4-[4-[2-[4-[4-(4-triphenylphosphaniumylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]phosphanium dichloride.
| Compound Name | triphenyl-[4-[4-[4-[2-[4-[4-(4-triphenylphosphaniumylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]phosphanium dichloride |
|---|---|
| PubChem CID | 169426235 |
| Molecular Formula | C77H60Cl2O4P2 |
| Molecular Weight | 1182.18 g/mol |
| Exact Mass | 1180.33 |
| IUPAC Name | triphenyl-[4-[4-[4-[2-[4-[4-(4-triphenylphosphaniumylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]phosphanium dichloride |
| SMILES | CC(C)(c1ccc(Oc2ccc(C(=O)c3ccc([P+](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc2)cc1)c1ccc(Oc2ccc(C(=O)c3ccc([P+](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C77H60O4P2.2ClH/c1-77(2,61-41-49-65(50-42-61)80-63-45-33-57(34-46-63)75(78)59-37-53-73(54-38-59)82(67-21-9-3-10-22-67,68-23-11-4-12-24-68)69-25-13-5-14-26-69)62-43-51-66(52-44-62)81-64-47-35-58(36-48-64)76(79)60-39-55-74(56-40-60)83(70-27-15-6-16-28-70,71-29-17-7-18-30-71)72-31-19-8-20-32-72;;/h3-56H,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | ODANCVDNZVMCEU-UHFFFAOYSA-L |
| XLogP | 9.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1182.18 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|