C22H21NOS — CID 20986191
4-[4-(2-phenylpropan-2-yl)phenoxy]benzenecarbothioamide (PubChem CID 20986191) has the molecular formula C22H21NOS and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-[4-(2-phenylpropan-2-yl)phenoxy]benzenecarbothioamide.
| Compound Name | 4-[4-(2-phenylpropan-2-yl)phenoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 20986191 |
| Molecular Formula | C22H21NOS |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-[4-(2-phenylpropan-2-yl)phenoxy]benzenecarbothioamide |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2ccc(C(N)=S)cc2)cc1 |
| InChI | InChI=1S/C22H21NOS/c1-22(2,17-6-4-3-5-7-17)18-10-14-20(15-11-18)24-19-12-8-16(9-13-19)21(23)25/h3-15H,1-2H3,(H2,23,25) |
| InChIKey | VCHTUTUPAACALT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|