C17H18OS — CID 12030861
2,2-dimethyl-1-(4-phenoxyphenyl)propane-1-thione (PubChem CID 12030861) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-phenoxyphenyl)propane-1-thione.
| Compound Name | 2,2-dimethyl-1-(4-phenoxyphenyl)propane-1-thione |
|---|---|
| PubChem CID | 12030861 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2,2-dimethyl-1-(4-phenoxyphenyl)propane-1-thione |
| SMILES | CC(C)(C)C(=S)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18OS/c1-17(2,3)16(19)13-9-11-15(12-10-13)18-14-7-5-4-6-8-14/h4-12H,1-3H3 |
| InChIKey | VEDOHLILUOJFEY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|