C15H12O4S2 — CID 88840278
3-oxo-3-(4-phenoxyphenyl)-2,2-bis(sulfanyl)propanoic acid (PubChem CID 88840278) has the molecular formula C15H12O4S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-oxo-3-(4-phenoxyphenyl)-2,2-bis(sulfanyl)propanoic acid.
| Compound Name | 3-oxo-3-(4-phenoxyphenyl)-2,2-bis(sulfanyl)propanoic acid |
|---|---|
| PubChem CID | 88840278 |
| Molecular Formula | C15H12O4S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-oxo-3-(4-phenoxyphenyl)-2,2-bis(sulfanyl)propanoic acid |
| SMILES | O=C(O)C(S)(S)C(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C15H12O4S2/c16-13(15(20,21)14(17)18)10-6-8-12(9-7-10)19-11-4-2-1-3-5-11/h1-9,20-21H,(H,17,18) |
| InChIKey | SBMRCOKLJXBLBT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|