C34H22O6 — CID 20508401
1-[3-[2-oxo-2-(4-phenoxyphenyl)acetyl]phenyl]-2-(4-phenoxyphenyl)ethane-1,2-dione (PubChem CID 20508401) has the molecular formula C34H22O6 and a molecular weight of 526.54 g/mol. Its IUPAC name is 1-[3-[2-oxo-2-(4-phenoxyphenyl)acetyl]phenyl]-2-(4-phenoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[3-[2-oxo-2-(4-phenoxyphenyl)acetyl]phenyl]-2-(4-phenoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 20508401 |
| Molecular Formula | C34H22O6 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 1-[3-[2-oxo-2-(4-phenoxyphenyl)acetyl]phenyl]-2-(4-phenoxyphenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cccc(C(=O)C(=O)c2ccc(Oc3ccccc3)cc2)c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C34H22O6/c35-31(23-14-18-29(19-15-23)39-27-10-3-1-4-11-27)33(37)25-8-7-9-26(22-25)34(38)32(36)24-16-20-30(21-17-24)40-28-12-5-2-6-13-28/h1-22H |
| InChIKey | DUQZPRDKOFQUSA-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|