About 4-phenoxybenzoyl bromide
4-phenoxybenzoyl bromide (PubChem CID 116924551) has the molecular formula C13H9BrO2
and a molecular weight of 277.12 g/mol. Its IUPAC name is 4-phenoxybenzoyl bromide.
Molecular Properties
| Compound Name | 4-phenoxybenzoyl bromide |
| PubChem CID | 116924551 |
| Molecular Formula | C13H9BrO2 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 4-phenoxybenzoyl bromide |
| SMILES | O=C(Br)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C13H9BrO2/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H |
| InChIKey | INHJAHQXPYNZJZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-phenoxybenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxybenzoyl bromide?
The IUPAC name of 4-phenoxybenzoyl bromide (CID 116924551) is 4-phenoxybenzoyl bromide.
What is the SMILES notation for 4-phenoxybenzoyl bromide?
The canonical SMILES for 4-phenoxybenzoyl bromide is O=C(Br)c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-phenoxybenzoyl bromide?
The InChIKey is INHJAHQXPYNZJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrO2/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H.
What are the key properties of 4-phenoxybenzoyl bromide?
4-phenoxybenzoyl bromide has a molecular weight of 277.12 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxybenzoyl bromide is sourced from PubChem (CID 116924551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).