About benzoyl bromide
benzoyl bromide (PubChem CID 12056) has the molecular formula C7H5BrO
and a molecular weight of 185.02 g/mol. Its IUPAC name is benzoyl bromide.
Molecular Properties
| Compound Name | benzoyl bromide |
| PubChem CID | 12056 |
| Molecular Formula | C7H5BrO |
| Molecular Weight | 185.02 g/mol |
| Exact Mass | 183.95 |
| IUPAC Name | benzoyl bromide |
| SMILES | O=C(Br)c1ccccc1 |
| InChI | InChI=1S/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| InChIKey | AQIHMSVIAGNIDM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.02 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl bromide?
The IUPAC name of benzoyl bromide (CID 12056) is benzoyl bromide.
What is the SMILES notation for benzoyl bromide?
The canonical SMILES for benzoyl bromide is O=C(Br)c1ccccc1.
What is the InChIKey of benzoyl bromide?
The InChIKey is AQIHMSVIAGNIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H.
What are the key properties of benzoyl bromide?
benzoyl bromide has a molecular weight of 185.02 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl bromide is sourced from PubChem (CID 12056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).