C14H11FO2 — CID 158476796
1,2-diphenylethane-1,2-dione;hydrofluoride (PubChem CID 158476796) has the molecular formula C14H11FO2 and a molecular weight of 230.24 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;hydrofluoride.
| Compound Name | 1,2-diphenylethane-1,2-dione;hydrofluoride |
|---|---|
| PubChem CID | 158476796 |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;hydrofluoride |
| SMILES | F.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.FH/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;/h1-10H;1H |
| InChIKey | JWQGBBKUNRMGFC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|