C17H14Cl4O2 — CID 88738435
1,2-diphenylethane-1,2-dione;methane;1,1,2,2-tetrachloroethene (PubChem CID 88738435) has the molecular formula C17H14Cl4O2 and a molecular weight of 392.11 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;methane;1,1,2,2-tetrachloroethene.
| Compound Name | 1,2-diphenylethane-1,2-dione;methane;1,1,2,2-tetrachloroethene |
|---|---|
| PubChem CID | 88738435 |
| Molecular Formula | C17H14Cl4O2 |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;methane;1,1,2,2-tetrachloroethene |
| SMILES | C.ClC(Cl)=C(Cl)Cl.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C2Cl4.CH4/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;3-1(4)2(5)6;/h1-10H;;1H4 |
| InChIKey | ZOEUMFQROWUZPK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|