C28H22O4SiZr — CID 158973097
bis(1,2-diphenylethane-1,2-dione);silylidenezirconium (PubChem CID 158973097) has the molecular formula C28H22O4SiZr and a molecular weight of 541.79 g/mol. Its IUPAC name is bis(1,2-diphenylethane-1,2-dione);silylidenezirconium.
| Compound Name | bis(1,2-diphenylethane-1,2-dione);silylidenezirconium |
|---|---|
| PubChem CID | 158973097 |
| Molecular Formula | C28H22O4SiZr |
| Molecular Weight | 541.79 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | bis(1,2-diphenylethane-1,2-dione);silylidenezirconium |
| SMILES | O=C(C(=O)c1ccccc1)c1ccccc1.O=C(C(=O)c1ccccc1)c1ccccc1.[SiH2]=[Zr] |
| InChI | InChI=1S/2C14H10O2.H2Si.Zr/c2*15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;;/h2*1-10H;1H2; |
| InChIKey | JOBGAAAYFUYEOR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|