C18H10O4 — CID 134874664
2,3-dibenzoylbuta-1,3-diene-1,4-dione (PubChem CID 134874664) has the molecular formula C18H10O4 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2,3-dibenzoylbuta-1,3-diene-1,4-dione.
| Compound Name | 2,3-dibenzoylbuta-1,3-diene-1,4-dione |
|---|---|
| PubChem CID | 134874664 |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2,3-dibenzoylbuta-1,3-diene-1,4-dione |
| SMILES | O=C=C(C(=O)c1ccccc1)C(=C=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H10O4/c19-11-15(17(21)13-7-3-1-4-8-13)16(12-20)18(22)14-9-5-2-6-10-14/h1-10H |
| InChIKey | JQRQDRKKDZSWQQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|