C16H12O — CID 44551870
1,2-diphenylbuta-2,3-dien-1-one (PubChem CID 44551870) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is 1,2-diphenylbuta-2,3-dien-1-one.
| Compound Name | 1,2-diphenylbuta-2,3-dien-1-one |
|---|---|
| PubChem CID | 44551870 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1,2-diphenylbuta-2,3-dien-1-one |
| SMILES | C=C=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12O/c1-2-15(13-9-5-3-6-10-13)16(17)14-11-7-4-8-12-14/h3-12H,1H2 |
| InChIKey | QQKJBUXKYULSIX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|