About 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate
1-phenyl-2-phosphorosoethane-1,2-dione;hydrate (PubChem CID 174267019) has the molecular formula C8H7O4P
and a molecular weight of 198.11 g/mol. Its IUPAC name is 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate.
Molecular Properties
| Compound Name | 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate |
| PubChem CID | 174267019 |
| Molecular Formula | C8H7O4P |
| Molecular Weight | 198.11 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate |
| SMILES | O.O=PC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C8H5O3P.H2O/c9-7(8(10)12-11)6-4-2-1-3-5-6;/h1-5H;1H2 |
| InChIKey | MOJJMAHALSDXTJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 82.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.11 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate?
The IUPAC name of 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate (CID 174267019) is 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate.
What is the SMILES notation for 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate?
The canonical SMILES for 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate is O.O=PC(=O)C(=O)c1ccccc1.
What is the InChIKey of 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate?
The InChIKey is MOJJMAHALSDXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5O3P.H2O/c9-7(8(10)12-11)6-4-2-1-3-5-6;/h1-5H;1H2.
What are the key properties of 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate?
1-phenyl-2-phosphorosoethane-1,2-dione;hydrate has a molecular weight of 198.11 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-phosphorosoethane-1,2-dione;hydrate is sourced from PubChem (CID 174267019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).