About 2-oxo-2-phenylacetic acid;yttrium
2-oxo-2-phenylacetic acid;yttrium (PubChem CID 20801354) has the molecular formula C8H6O3Y
and a molecular weight of 239.04 g/mol. Its IUPAC name is 2-oxo-2-phenylacetic acid;yttrium.
Molecular Properties
| Compound Name | 2-oxo-2-phenylacetic acid;yttrium |
| PubChem CID | 20801354 |
| Molecular Formula | C8H6O3Y |
| Molecular Weight | 239.04 g/mol |
| Exact Mass | 238.94 |
| IUPAC Name | 2-oxo-2-phenylacetic acid;yttrium |
| SMILES | O=C(O)C(=O)c1ccccc1.[Y] |
| InChI | InChI=1S/C8H6O3.Y/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5H,(H,10,11); |
| InChIKey | NYWPAJNUARNVJC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.04 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-phenylacetic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-phenylacetic acid;yttrium?
The IUPAC name of 2-oxo-2-phenylacetic acid;yttrium (CID 20801354) is 2-oxo-2-phenylacetic acid;yttrium.
What is the SMILES notation for 2-oxo-2-phenylacetic acid;yttrium?
The canonical SMILES for 2-oxo-2-phenylacetic acid;yttrium is O=C(O)C(=O)c1ccccc1.[Y].
What is the InChIKey of 2-oxo-2-phenylacetic acid;yttrium?
The InChIKey is NYWPAJNUARNVJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3.Y/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5H,(H,10,11);.
What are the key properties of 2-oxo-2-phenylacetic acid;yttrium?
2-oxo-2-phenylacetic acid;yttrium has a molecular weight of 239.04 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-phenylacetic acid;yttrium is sourced from PubChem (CID 20801354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).