C28H22O6 — CID 18415505
bis(1,2-diphenylethane-1,2-dione);hydrogen peroxide (PubChem CID 18415505) has the molecular formula C28H22O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is bis(1,2-diphenylethane-1,2-dione);hydrogen peroxide.
| Compound Name | bis(1,2-diphenylethane-1,2-dione);hydrogen peroxide |
|---|---|
| PubChem CID | 18415505 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | bis(1,2-diphenylethane-1,2-dione);hydrogen peroxide |
| SMILES | O=C(C(=O)c1ccccc1)c1ccccc1.O=C(C(=O)c1ccccc1)c1ccccc1.OO |
| InChI | InChI=1S/2C14H10O2.H2O2/c2*15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-2/h2*1-10H;1-2H |
| InChIKey | UUTLMSQCHQCKCK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|