About diphenylmethanone
diphenylmethanone (PubChem CID 3102) has the molecular formula C13H10O
and a molecular weight of 182.22 g/mol. Its IUPAC name is diphenylmethanone.
Molecular Properties
| Compound Name | diphenylmethanone |
| PubChem CID | 3102 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | diphenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone?
The IUPAC name of diphenylmethanone (CID 3102) is diphenylmethanone.
What is the SMILES notation for diphenylmethanone?
The canonical SMILES for diphenylmethanone is O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone?
The InChIKey is RWCCWEUUXYIKHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of diphenylmethanone?
diphenylmethanone has a molecular weight of 182.22 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone is sourced from PubChem (CID 3102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).