About magnesium;diphenylmethanone;hydride
magnesium;diphenylmethanone;hydride (PubChem CID 175114327) has the molecular formula C13H12MgO
and a molecular weight of 208.54 g/mol. Its IUPAC name is magnesium;diphenylmethanone;hydride.
Molecular Properties
| Compound Name | magnesium;diphenylmethanone;hydride |
| PubChem CID | 175114327 |
| Molecular Formula | C13H12MgO |
| Molecular Weight | 208.54 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | magnesium;diphenylmethanone;hydride |
| SMILES | O=C(c1ccccc1)c1ccccc1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C13H10O.Mg.2H/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10H;;;/q;+2;2*-1 |
| InChIKey | PEMWYMOLMMSXOH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;diphenylmethanone;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;diphenylmethanone;hydride?
The IUPAC name of magnesium;diphenylmethanone;hydride (CID 175114327) is magnesium;diphenylmethanone;hydride.
What is the SMILES notation for magnesium;diphenylmethanone;hydride?
The canonical SMILES for magnesium;diphenylmethanone;hydride is O=C(c1ccccc1)c1ccccc1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;diphenylmethanone;hydride?
The InChIKey is PEMWYMOLMMSXOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.Mg.2H/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10H;;;/q;+2;2*-1.
What are the key properties of magnesium;diphenylmethanone;hydride?
magnesium;diphenylmethanone;hydride has a molecular weight of 208.54 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;diphenylmethanone;hydride is sourced from PubChem (CID 175114327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).