About diphenylmethanone;ethane
diphenylmethanone;ethane (PubChem CID 158014879) has the molecular formula C23H40O
and a molecular weight of 332.57 g/mol. Its IUPAC name is diphenylmethanone;ethane.
Molecular Properties
| Compound Name | diphenylmethanone;ethane |
| PubChem CID | 158014879 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | diphenylmethanone;ethane |
| SMILES | CC.CC.CC.CC.CC.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.5C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;5*1-2/h1-10H;5*1-2H3 |
| InChIKey | FFIGYZVFJPFQCV-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;ethane?
The IUPAC name of diphenylmethanone;ethane (CID 158014879) is diphenylmethanone;ethane.
What is the SMILES notation for diphenylmethanone;ethane?
The canonical SMILES for diphenylmethanone;ethane is CC.CC.CC.CC.CC.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;ethane?
The InChIKey is FFIGYZVFJPFQCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.5C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;5*1-2/h1-10H;5*1-2H3.
What are the key properties of diphenylmethanone;ethane?
diphenylmethanone;ethane has a molecular weight of 332.57 g/mol, XLogP of 8.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;ethane is sourced from PubChem (CID 158014879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).