About diphenylmethanone;ethane;toluene
diphenylmethanone;ethane;toluene (PubChem CID 157406780) has the molecular formula C26H36O
and a molecular weight of 364.57 g/mol. Its IUPAC name is diphenylmethanone;ethane;toluene.
Molecular Properties
| Compound Name | diphenylmethanone;ethane;toluene |
| PubChem CID | 157406780 |
| Molecular Formula | C26H36O |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | diphenylmethanone;ethane;toluene |
| SMILES | CC.CC.CC.Cc1ccccc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C7H8.3C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-7-5-3-2-4-6-7;3*1-2/h1-10H;2-6H,1H3;3*1-2H3 |
| InChIKey | BNURCWRVCCEIID-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanone;ethane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;ethane;toluene?
The IUPAC name of diphenylmethanone;ethane;toluene (CID 157406780) is diphenylmethanone;ethane;toluene.
What is the SMILES notation for diphenylmethanone;ethane;toluene?
The canonical SMILES for diphenylmethanone;ethane;toluene is CC.CC.CC.Cc1ccccc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;ethane;toluene?
The InChIKey is BNURCWRVCCEIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C7H8.3C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-7-5-3-2-4-6-7;3*1-2/h1-10H;2-6H,1H3;3*1-2H3.
What are the key properties of diphenylmethanone;ethane;toluene?
diphenylmethanone;ethane;toluene has a molecular weight of 364.57 g/mol, XLogP of 7.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;ethane;toluene is sourced from PubChem (CID 157406780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).