About diphenylmethanone;(4-methylphenyl)-phenylmethanone
diphenylmethanone;(4-methylphenyl)-phenylmethanone (PubChem CID 69336781) has the molecular formula C27H22O2
and a molecular weight of 378.47 g/mol. Its IUPAC name is diphenylmethanone;(4-methylphenyl)-phenylmethanone.
Molecular Properties
| Compound Name | diphenylmethanone;(4-methylphenyl)-phenylmethanone |
| PubChem CID | 69336781 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | diphenylmethanone;(4-methylphenyl)-phenylmethanone |
| SMILES | Cc1ccc(C(=O)c2ccccc2)cc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O.C13H10O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2-10H,1H3;1-10H |
| InChIKey | RLGQLKYQBOXVPP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenylmethanone;(4-methylphenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;(4-methylphenyl)-phenylmethanone?
The IUPAC name of diphenylmethanone;(4-methylphenyl)-phenylmethanone (CID 69336781) is diphenylmethanone;(4-methylphenyl)-phenylmethanone.
What is the SMILES notation for diphenylmethanone;(4-methylphenyl)-phenylmethanone?
The canonical SMILES for diphenylmethanone;(4-methylphenyl)-phenylmethanone is Cc1ccc(C(=O)c2ccccc2)cc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;(4-methylphenyl)-phenylmethanone?
The InChIKey is RLGQLKYQBOXVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.C13H10O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2-10H,1H3;1-10H.
What are the key properties of diphenylmethanone;(4-methylphenyl)-phenylmethanone?
diphenylmethanone;(4-methylphenyl)-phenylmethanone has a molecular weight of 378.47 g/mol, XLogP of 6.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;(4-methylphenyl)-phenylmethanone is sourced from PubChem (CID 69336781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).