C20H29BO6 — CID 175517764
boric acid;2,3-dimethylbutane-2,3-diol;(4-methylphenyl)-phenylmethanone (PubChem CID 175517764) has the molecular formula C20H29BO6 and a molecular weight of 376.26 g/mol. Its IUPAC name is boric acid;2,3-dimethylbutane-2,3-diol;(4-methylphenyl)-phenylmethanone.
| Compound Name | boric acid;2,3-dimethylbutane-2,3-diol;(4-methylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 175517764 |
| Molecular Formula | C20H29BO6 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | boric acid;2,3-dimethylbutane-2,3-diol;(4-methylphenyl)-phenylmethanone |
| SMILES | CC(C)(O)C(C)(C)O.Cc1ccc(C(=O)c2ccccc2)cc1.OB(O)O |
| InChI | InChI=1S/C14H12O.C6H14O2.BH3O3/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12;1-5(2,7)6(3,4)8;2-1(3)4/h2-10H,1H3;7-8H,1-4H3;2-4H |
| InChIKey | RHFAVNBRPTYPGQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|