C24H22O4S — CID 141452224
1-(4-benzoylphenyl)-2-methyl-2-(4-methylphenyl)sulfonylpropan-1-one (PubChem CID 141452224) has the molecular formula C24H22O4S and a molecular weight of 406.50 g/mol. Its IUPAC name is 1-(4-benzoylphenyl)-2-methyl-2-(4-methylphenyl)sulfonylpropan-1-one.
| Compound Name | 1-(4-benzoylphenyl)-2-methyl-2-(4-methylphenyl)sulfonylpropan-1-one |
|---|---|
| PubChem CID | 141452224 |
| Molecular Formula | C24H22O4S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-(4-benzoylphenyl)-2-methyl-2-(4-methylphenyl)sulfonylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C(C)(C)C(=O)c2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H22O4S/c1-17-9-15-21(16-10-17)29(27,28)24(2,3)23(26)20-13-11-19(12-14-20)22(25)18-7-5-4-6-8-18/h4-16H,1-3H3 |
| InChIKey | QPNFQJUTMKELDS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |