C30H26O4S3 — CID 58203140
2-methyl-2-(4-methylphenyl)sulfonyl-1-[4-[4-(4-sulfanylbenzoyl)phenyl]sulfanylphenyl]propan-1-one (PubChem CID 58203140) has the molecular formula C30H26O4S3 and a molecular weight of 546.74 g/mol. Its IUPAC name is 2-methyl-2-(4-methylphenyl)sulfonyl-1-[4-[4-(4-sulfanylbenzoyl)phenyl]sulfanylphenyl]propan-1-one.
| Compound Name | 2-methyl-2-(4-methylphenyl)sulfonyl-1-[4-[4-(4-sulfanylbenzoyl)phenyl]sulfanylphenyl]propan-1-one |
|---|---|
| PubChem CID | 58203140 |
| Molecular Formula | C30H26O4S3 |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 2-methyl-2-(4-methylphenyl)sulfonyl-1-[4-[4-(4-sulfanylbenzoyl)phenyl]sulfanylphenyl]propan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C(C)(C)C(=O)c2ccc(Sc3ccc(C(=O)c4ccc(S)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H26O4S3/c1-20-4-18-27(19-5-20)37(33,34)30(2,3)29(32)23-10-16-26(17-11-23)36-25-14-8-22(9-15-25)28(31)21-6-12-24(35)13-7-21/h4-19,35H,1-3H3 |
| InChIKey | NRUGDARQEGWQRZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|