C18H20O4S2 — CID 58205278
[2-methyl-1-(4-methylsulfanylphenyl)-1-oxopropan-2-yl] 4-methylbenzenesulfonate (PubChem CID 58205278) has the molecular formula C18H20O4S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is [2-methyl-1-(4-methylsulfanylphenyl)-1-oxopropan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-methyl-1-(4-methylsulfanylphenyl)-1-oxopropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58205278 |
| Molecular Formula | C18H20O4S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [2-methyl-1-(4-methylsulfanylphenyl)-1-oxopropan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CSc1ccc(C(=O)C(C)(C)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20O4S2/c1-13-5-11-16(12-6-13)24(20,21)22-18(2,3)17(19)14-7-9-15(23-4)10-8-14/h5-12H,1-4H3 |
| InChIKey | MRKAJOQLISLYRI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|