About [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite
[3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite (PubChem CID 20695859) has the molecular formula C20H24O4S2
and a molecular weight of 392.54 g/mol. Its IUPAC name is [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite.
Molecular Properties
| Compound Name | [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite |
| PubChem CID | 20695859 |
| Molecular Formula | C20H24O4S2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite |
| SMILES | CSc1ccc(C(=O)C(C)(C)C(C)OS(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H24O4S2/c1-14-6-10-17(11-7-14)24-26(22)23-15(2)20(3,4)19(21)16-8-12-18(25-5)13-9-16/h6-13,15H,1-5H3 |
| InChIKey | FIHRDHOSWHNSPX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite?
The IUPAC name of [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite (CID 20695859) is [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite.
What is the SMILES notation for [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite?
The canonical SMILES for [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite is CSc1ccc(C(=O)C(C)(C)C(C)OS(=O)Oc2ccc(C)cc2)cc1.
What is the InChIKey of [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite?
The InChIKey is FIHRDHOSWHNSPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O4S2/c1-14-6-10-17(11-7-14)24-26(22)23-15(2)20(3,4)19(21)16-8-12-18(25-5)13-9-16/h6-13,15H,1-5H3.
What are the key properties of [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite?
[3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite has a molecular weight of 392.54 g/mol, XLogP of 4.99, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutan-2-yl] (4-methylphenyl) sulfite is sourced from PubChem (CID 20695859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).