About (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite
(3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite (PubChem CID 22081687) has the molecular formula C12H18O4S
and a molecular weight of 258.34 g/mol. Its IUPAC name is (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite.
Molecular Properties
| Compound Name | (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite |
| PubChem CID | 22081687 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite |
| SMILES | Cc1ccc(OS(=O)OC(C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C12H18O4S/c1-9-5-7-11(8-6-9)16-17(14)15-10(2)12(3,4)13/h5-8,10,13H,1-4H3 |
| InChIKey | IQMGOGRUDCTJDM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite?
The IUPAC name of (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite (CID 22081687) is (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite.
What is the SMILES notation for (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite?
The canonical SMILES for (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite is Cc1ccc(OS(=O)OC(C)C(C)(C)O)cc1.
What is the InChIKey of (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite?
The InChIKey is IQMGOGRUDCTJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4S/c1-9-5-7-11(8-6-9)16-17(14)15-10(2)12(3,4)13/h5-8,10,13H,1-4H3.
What are the key properties of (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite?
(3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite has a molecular weight of 258.34 g/mol, XLogP of 2.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-3-methylbutan-2-yl) (4-methylphenyl) sulfite is sourced from PubChem (CID 22081687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).