About (3-methylphenyl) (4-methylphenyl) sulfite
(3-methylphenyl) (4-methylphenyl) sulfite (PubChem CID 174586791) has the molecular formula C14H14O3S
and a molecular weight of 262.33 g/mol. Its IUPAC name is (3-methylphenyl) (4-methylphenyl) sulfite.
Molecular Properties
| Compound Name | (3-methylphenyl) (4-methylphenyl) sulfite |
| PubChem CID | 174586791 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | (3-methylphenyl) (4-methylphenyl) sulfite |
| SMILES | Cc1ccc(OS(=O)Oc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C14H14O3S/c1-11-6-8-13(9-7-11)16-18(15)17-14-5-3-4-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | LGOMIQLAQWUAIG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylphenyl) (4-methylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl) (4-methylphenyl) sulfite?
The IUPAC name of (3-methylphenyl) (4-methylphenyl) sulfite (CID 174586791) is (3-methylphenyl) (4-methylphenyl) sulfite.
What is the SMILES notation for (3-methylphenyl) (4-methylphenyl) sulfite?
The canonical SMILES for (3-methylphenyl) (4-methylphenyl) sulfite is Cc1ccc(OS(=O)Oc2cccc(C)c2)cc1.
What is the InChIKey of (3-methylphenyl) (4-methylphenyl) sulfite?
The InChIKey is LGOMIQLAQWUAIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3S/c1-11-6-8-13(9-7-11)16-18(15)17-14-5-3-4-12(2)10-14/h3-10H,1-2H3.
What are the key properties of (3-methylphenyl) (4-methylphenyl) sulfite?
(3-methylphenyl) (4-methylphenyl) sulfite has a molecular weight of 262.33 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) (4-methylphenyl) sulfite is sourced from PubChem (CID 174586791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).