C20H32 — CID 145425556
ethane;1,3-xylene;1,4-xylene (PubChem CID 145425556) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is ethane;1,3-xylene;1,4-xylene.
| Compound Name | ethane;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 145425556 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | ethane;1,3-xylene;1,4-xylene |
| SMILES | CC.CC.Cc1ccc(C)cc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/2C8H10.2C2H6/c1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;2*1-2/h2*3-6H,1-2H3;2*1-2H3 |
| InChIKey | YOKIRVUINNYBEQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |