C30H34O — CID 159470463
1-methyl-4-(4-methylphenoxy)benzene;1,3-xylene;1,4-xylene (PubChem CID 159470463) has the molecular formula C30H34O and a molecular weight of 410.60 g/mol. Its IUPAC name is 1-methyl-4-(4-methylphenoxy)benzene;1,3-xylene;1,4-xylene.
| Compound Name | 1-methyl-4-(4-methylphenoxy)benzene;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 159470463 |
| Molecular Formula | C30H34O |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1-methyl-4-(4-methylphenoxy)benzene;1,3-xylene;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1ccc(Oc2ccc(C)cc2)cc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C14H14O.2C8H10/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7/h3-10H,1-2H3;2*3-6H,1-2H3 |
| InChIKey | LVSROGDYKRKYQG-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |